Information card for entry 7151249
| Formula |
C28 H34 N2 O3 |
| Calculated formula |
C28 H34 N2 O3 |
| SMILES |
[C@@H]12CCCC(=O)[C@@H]1N1[C@H](c3ccccc3)CN([C@H]1[C@H]2C(=O)OC(C)(C)C)Cc1ccccc1 |
| Title of publication |
Intramolecular 1,3-dipolar cycloadditions of dihydroimidazolium ylides: synthesis of pyrrolo[1,2,3-de]quinoxalines and imidazo[1,2-a]indoles. |
| Authors of publication |
Lory, Pedro M. J.; Jones, Raymond C. F.; Iley, James N.; Coles, Simon J.; Hursthouse, Michael B. |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2006 |
| Journal volume |
4 |
| Journal issue |
16 |
| Pages of publication |
3155 - 3165 |
| a |
5.8566 ± 0.0004 Å |
| b |
22.8548 ± 0.0018 Å |
| c |
9.1424 ± 0.0007 Å |
| α |
90° |
| β |
92.913 ± 0.006° |
| γ |
90° |
| Cell volume |
1222.14 ± 0.16 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0842 |
| Residual factor for significantly intense reflections |
0.05 |
| Weighted residual factors for significantly intense reflections |
0.0957 |
| Weighted residual factors for all reflections included in the refinement |
0.1075 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.014 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7151249.html