Information card for entry 7151816
| Common name |
Methyl 6,6-dimethyl-5,6-dihydroindolo(1,2-a)quinoxaline-3-carboxylate |
| Chemical name |
Methyl 6,6-dimethyl-5,6-dihydroindolo[1,2-a]quinoxaline-3-carboxylate |
| Formula |
C19 H18 N2 O2 |
| Calculated formula |
C19 H18 N2 O2 |
| SMILES |
C1(c2cc3ccccc3n2c2ccc(cc2N1)C(=O)OC)(C)C |
| Title of publication |
Soluble polymer supported divergent synthesis of tetracyclic benzene-fused pyrazino/diazepino indoles: an advanced synthetic approach to bioactive scaffolds. |
| Authors of publication |
Lin, Po-Tsung; Salunke, Deepak B.; Chen, Li-Hsun; Sun, Chung-Ming |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2011 |
| Journal volume |
9 |
| Journal issue |
8 |
| Pages of publication |
2925 - 2937 |
| a |
10.1275 ± 0.0004 Å |
| b |
19.1023 ± 0.0007 Å |
| c |
8.0831 ± 0.0003 Å |
| α |
90° |
| β |
106.182 ± 0.001° |
| γ |
90° |
| Cell volume |
1501.79 ± 0.1 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
7 |
| Hermann-Mauguin space group symbol |
P 1 c 1 |
| Hall space group symbol |
P -2yc |
| Residual factor for all reflections |
0.0344 |
| Residual factor for significantly intense reflections |
0.0318 |
| Weighted residual factors for significantly intense reflections |
0.0912 |
| Weighted residual factors for all reflections included in the refinement |
0.1044 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.15 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7151816.html