Information card for entry 7151868
| Formula |
C16 H16 N2 O5 |
| Calculated formula |
C16 H16 N2 O5 |
| SMILES |
O=C1N(C(=O)c2ccccc2[C@@]21OC(=N[C@]2(C(=O)OC)C)C)C.O=C1N(C(=O)c2ccccc2[C@]21OC(=N[C@@]2(C(=O)OC)C)C)C |
| Title of publication |
Facile synthesis of spiroisoquinolines based on photocycloaddition of isoquinoline-1,3,4-trione with oxazoles. |
| Authors of publication |
Huang, Chengmei; Yu, Haitao; Miao, Zhengrui; Zhou, Jie; Wang, Shuai; Fun, Hoong-Kun; Xu, Jianhua; Zhang, Yan |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2011 |
| Journal volume |
9 |
| Journal issue |
10 |
| Pages of publication |
3629 - 3631 |
| a |
9.2295 ± 0.0005 Å |
| b |
11.037 ± 0.0007 Å |
| c |
17.1487 ± 0.0008 Å |
| α |
90° |
| β |
121.994 ± 0.003° |
| γ |
90° |
| Cell volume |
1481.53 ± 0.15 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0419 |
| Residual factor for significantly intense reflections |
0.0363 |
| Weighted residual factors for significantly intense reflections |
0.1023 |
| Weighted residual factors for all reflections included in the refinement |
0.1077 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7151868.html