Information card for entry 7152392
| Formula |
C9 H7 I2 N3 O |
| Calculated formula |
C9 H7 I2 N3 O |
| SMILES |
c1(cnn(n1)c1cc(c(cc1)OC)I)I |
| Title of publication |
Deproto-metallation and computed CH acidity of 2-aryl-1,2,3-triazoles. |
| Authors of publication |
Chevallier, Floris; Blin, Thomas; Nagaradja, Elisabeth; Lassagne, Frédéric; Roisnel, Thierry; Halauko, Yury S.; Matulis, Vadim E.; Ivashkevich, Oleg A.; Mongin, Florence |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2012 |
| Journal volume |
10 |
| Journal issue |
25 |
| Pages of publication |
4878 - 4885 |
| a |
4.1304 ± 0.0002 Å |
| b |
12.9948 ± 0.0005 Å |
| c |
21.5358 ± 0.0009 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1155.91 ± 0.09 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P c 21 n |
| Hall space group symbol |
P -2n -2ac |
| Residual factor for all reflections |
0.0235 |
| Residual factor for significantly intense reflections |
0.0228 |
| Weighted residual factors for significantly intense reflections |
0.0498 |
| Weighted residual factors for all reflections included in the refinement |
0.0502 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.056 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7152392.html