Information card for entry 7153322
| Common name |
2-oxo-3,4,4a,7,8,8a-hexahydro-2H-chromene-6-carbaldehyde |
| Chemical name |
2-oxo-3,4,4a,7,8,8a-hexahydro-2H-chromene-6-carbaldehyde |
| Formula |
C10 H12 O3 |
| Calculated formula |
C10 H12 O3 |
| SMILES |
O1[C@H]2CCC(=C[C@@H]2CCC1=O)C=O.O1[C@@H]2CCC(=C[C@H]2CCC1=O)C=O |
| Title of publication |
Biomimetically relevant self-condensations of C5 units derived from lysine. |
| Authors of publication |
Salame, Rim; Gravel, Edmond; Retailleau, Pascal; Poupon, Erwan |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2010 |
| Journal volume |
8 |
| Journal issue |
11 |
| Pages of publication |
2522 - 2528 |
| a |
6.627 ± 0.001 Å |
| b |
13.282 ± 0.003 Å |
| c |
10.388 ± 0.002 Å |
| α |
90° |
| β |
96.38 ± 0.05° |
| γ |
90° |
| Cell volume |
908.7 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0955 |
| Residual factor for significantly intense reflections |
0.0731 |
| Weighted residual factors for significantly intense reflections |
0.1952 |
| Weighted residual factors for all reflections included in the refinement |
0.2177 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.077 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7153322.html