Information card for entry 7153917
| Formula |
C18 H19 N3 O3 |
| Calculated formula |
C18 H19 N3 O3 |
| SMILES |
O=C1N(C(=O)c2c3c1cc(N)cc3ccc2)CCN1CCOCC1 |
| Title of publication |
Synthesis, photophysical and cytotoxicity evaluations of DNA targeting agents based on 3-amino-1,8-naphthalimide derived Tröger's bases. |
| Authors of publication |
Murphy, Samantha; Bright, Sandra A.; Poynton, Fergus E.; McCabe, Thomas; Kitchen, Jonathan A.; Veale, Emma B.; Williams, D. Clive; Gunnlaugsson, Thorfinnur |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2014 |
| Journal volume |
12 |
| Journal issue |
34 |
| Pages of publication |
6610 - 6623 |
| a |
5.544 ± 0.0018 Å |
| b |
23.166 ± 0.008 Å |
| c |
12.365 ± 0.004 Å |
| α |
90° |
| β |
102.769 ± 0.004° |
| γ |
90° |
| Cell volume |
1548.8 ± 0.9 Å3 |
| Cell temperature |
108 ± 2 K |
| Ambient diffraction temperature |
108 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0907 |
| Residual factor for significantly intense reflections |
0.0599 |
| Weighted residual factors for significantly intense reflections |
0.17 |
| Weighted residual factors for all reflections included in the refinement |
0.2225 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.123 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7153917.html