Information card for entry 7155034
| Formula |
C23 H20 N4 |
| Calculated formula |
C23 H20 N4 |
| SMILES |
n1c(c2ncccc2)cc(c2ccc(N(C)C)cc2)cc1c1ccccn1 |
| Title of publication |
Tuning the photophysical properties of 4'-substituted terpyridines - an experimental and theoretical study. |
| Authors of publication |
Maroń, Anna; Szlapa, Agata; Klemens, Tomasz; Kula, Slawomir; Machura, Barbara; Krompiec, Stanisław; Małecki, Jan Grzegorz; Switlicka-Olszewska, Anna; Erfurt, Karol; Chrobok, Anna |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2016 |
| Journal volume |
14 |
| Journal issue |
15 |
| Pages of publication |
3793 - 3808 |
| a |
15.2591 ± 0.0005 Å |
| b |
7.75811 ± 0.00018 Å |
| c |
16.2453 ± 0.0004 Å |
| α |
90° |
| β |
105.972 ± 0.003° |
| γ |
90° |
| Cell volume |
1848.91 ± 0.09 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0494 |
| Residual factor for significantly intense reflections |
0.0432 |
| Weighted residual factors for significantly intense reflections |
0.1163 |
| Weighted residual factors for all reflections included in the refinement |
0.1237 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7155034.html