Information card for entry 7155195
| Formula |
C18 H12 N2 O2 |
| Calculated formula |
C18 H12 N2 O2 |
| SMILES |
o1c(c2ccccc2)cc(=O)n2nc(cc12)c1ccccc1 |
| Title of publication |
A rare γ-pyranopyrazole skeleton: design, one-pot synthesis and computational study. |
| Authors of publication |
Üçüncü, Muhammed; Cantürk, Ceren; Karakuş, Erman; Zeybek, Hüseyin; Bozkaya, Uğur; Soydaş, Emine; Şahin, Ertan; Emrullahoğlu, Mustafa |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2016 |
| Journal volume |
14 |
| Journal issue |
31 |
| Pages of publication |
7490 - 7494 |
| a |
4.7369 ± 0.0004 Å |
| b |
24.686 ± 0.002 Å |
| c |
12.2902 ± 0.0013 Å |
| α |
90° |
| β |
99.492 ± 0.003° |
| γ |
90° |
| Cell volume |
1417.5 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.112 |
| Residual factor for significantly intense reflections |
0.0457 |
| Weighted residual factors for significantly intense reflections |
0.1014 |
| Weighted residual factors for all reflections included in the refinement |
0.1289 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.998 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7155195.html