Information card for entry 7155683
| Formula |
C20 H17 N5 O |
| Calculated formula |
C20 H17 N5 O |
| SMILES |
c1(N(C)C)ncn2c(c(c3ccccc3)nc2n1)C(=O)c1ccccc1 |
| Title of publication |
Copper (II) catalyzed iodine-promoted oxidative cyclization of 2-amino-1,3,5-triazines and chalcones: synthesis of aroylimidazo[1,2-a][1,3,5]triazines |
| Authors of publication |
cui, dongmei; Zhang, Chen; Li, JInjing; Song, Chan |
| Journal of publication |
Org. Biomol. Chem. |
| Year of publication |
2017 |
| a |
8.2708 ± 0.0005 Å |
| b |
19.5714 ± 0.0012 Å |
| c |
10.5066 ± 0.0008 Å |
| α |
90° |
| β |
103.832 ± 0.002° |
| γ |
90° |
| Cell volume |
1651.4 ± 0.19 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1242 |
| Residual factor for significantly intense reflections |
0.0639 |
| Weighted residual factors for significantly intense reflections |
0.1244 |
| Weighted residual factors for all reflections included in the refinement |
0.1556 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.001 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7155683.html