Information card for entry 7155818
| Chemical name |
N-Phenyl-1,8-naphthalimide Derived Trogers base |
| Formula |
C40 H26 Cl2 N4 O4 |
| Calculated formula |
C40 H26 Cl2 N4 O4 |
| SMILES |
ClCCl.O=C1N(c2ccccc2)C(=O)c2cc3c(N4Cc5cc6c7c(cccc7c5N(C3)C4)C(=O)N(C6=O)c3ccccc3)c3cccc1c23 |
| Title of publication |
One-pot facile synthesis of 4-amino-1,8-naphthalimide derived Tröger’s bases via a nucleophilic displacement approach |
| Authors of publication |
Gunnlaugsson, Thorfinnur; Shanmugaraju, Sankarasekaran; McAdams, Deirdre; Pancotti, Francesca; Hawes, Chris Samuel; Veale, Emma; Kitchen, Jonathan A. |
| Journal of publication |
Org. Biomol. Chem. |
| Year of publication |
2017 |
| a |
10.406 ± 0.002 Å |
| b |
11.383 ± 0.003 Å |
| c |
13.621 ± 0.003 Å |
| α |
83.448 ± 0.009° |
| β |
87.082 ± 0.001° |
| γ |
78.674 ± 0.01° |
| Cell volume |
1571 ± 0.6 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100.15 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0644 |
| Residual factor for significantly intense reflections |
0.0577 |
| Weighted residual factors for significantly intense reflections |
0.1644 |
| Weighted residual factors for all reflections included in the refinement |
0.1702 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.048 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7155818.html
