Information card for entry 7155920
| Chemical name |
methyl 1-(2-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| Formula |
C19 H17 N3 O4 |
| Calculated formula |
C19 H17 N3 O4 |
| SMILES |
O=C(OC)[C@@H]1N[C@H](c2c(N(=O)=O)cccc2)c2[nH]c3c(c2C1)cccc3 |
| Title of publication |
A diversity oriented synthesis of natural product inspired molecular libraries |
| Authors of publication |
Sen, Subhabrata; Chauhan, Jyoti; Luthra, Tania; Gundla, Rambabu; Ferraro, Antonio; Holzgrabe, Ulrike |
| Journal of publication |
Org. Biomol. Chem. |
| Year of publication |
2017 |
| a |
8.962 ± 0.003 Å |
| b |
9.634 ± 0.005 Å |
| c |
20.046 ± 0.011 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1730.8 ± 1.4 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0689 |
| Residual factor for significantly intense reflections |
0.0483 |
| Weighted residual factors for significantly intense reflections |
0.1121 |
| Weighted residual factors for all reflections included in the refinement |
0.1345 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.092 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7155920.html