Information card for entry 7155922
| Chemical name |
(2S,3R,4S,5R)-3-hydroxy-4,5-O-(1-methylethylidene)-2-methyl-piperidine |
| Formula |
C9 H17 N O3 |
| Calculated formula |
C9 H17 N O3 |
| SMILES |
N1[C@H]([C@@H](O)[C@@H]2OC(O[C@@H]2C1)(C)C)C |
| Title of publication |
Accessing 2-substituted piperidine iminosugars by organometallic addition/intramolecular reductive amination: aldehyde vs nitrone route |
| Authors of publication |
Mirabella, Stefania; Fibbi, Giulia; Matassini, Camilla; Faggi, Cristina; Goti, Andrea; Cardona, Francesca |
| Journal of publication |
Org. Biomol. Chem. |
| Year of publication |
2017 |
| a |
5.5 ± 0.0002 Å |
| b |
9.816 ± 0.0003 Å |
| c |
18.586 ± 0.0006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1003.42 ± 0.06 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0541 |
| Residual factor for significantly intense reflections |
0.0384 |
| Weighted residual factors for significantly intense reflections |
0.0828 |
| Weighted residual factors for all reflections included in the refinement |
0.0882 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.984 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7155922.html