Information card for entry 7157455
| Formula |
C23 H14 O2 |
| Calculated formula |
C23 H14 O2 |
| SMILES |
c1(=O)c(c(c2c(cccc2)o1)c1ccccc1)C#Cc1ccccc1 |
| Title of publication |
A visible-light-induced "on-off" one-pot synthesis of 3-arylacetylene coumarins with AIE properties. |
| Authors of publication |
Wu, Xinjie; Jia, Ming; Huang, Mengmeng; Kim, Jung Keun; Zhao, Zheng; Liu, Junkai; Xi, Jinhu; Li, Yabo; Wu, Yangjie |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2020 |
| Journal volume |
18 |
| Journal issue |
17 |
| Pages of publication |
3346 - 3353 |
| a |
10.9195 ± 0.0008 Å |
| b |
11.7513 ± 0.0007 Å |
| c |
14.206 ± 0.0006 Å |
| α |
87.69 ± 0.005° |
| β |
77.763 ± 0.005° |
| γ |
71.943 ± 0.006° |
| Cell volume |
1693.1 ± 0.19 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0637 |
| Residual factor for significantly intense reflections |
0.0473 |
| Weighted residual factors for significantly intense reflections |
0.1252 |
| Weighted residual factors for all reflections included in the refinement |
0.1428 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.018 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7157455.html