Information card for entry 7158533
| Formula |
C14 H16 O3 |
| Calculated formula |
C14 H16 O3 |
| SMILES |
O[C@@]12Oc3ccc(cc3[C@@]1(CCC(=O)C2)C)C |
| Title of publication |
A concise synthesis of herbertenolide |
| Authors of publication |
Hu, Jiadong; Ji, Kai; Yan, Lihong; Yang, Siyu; Li, Yin; Wen, Wen; Chen, Le; Wu, Xiaohui; Hu, Youcai; Xie, Weiqing |
| Journal of publication |
Organic & Biomolecular Chemistry |
| Year of publication |
2022 |
| a |
7.3015 ± 0.0001 Å |
| b |
11.6303 ± 0.0002 Å |
| c |
28.2622 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2399.99 ± 0.06 Å3 |
| Cell temperature |
172.97 ± 0.13 K |
| Ambient diffraction temperature |
172.97 ± 0.13 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.032 |
| Residual factor for significantly intense reflections |
0.0311 |
| Weighted residual factors for significantly intense reflections |
0.0787 |
| Weighted residual factors for all reflections included in the refinement |
0.0793 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7158533.html