Information card for entry 7202062
| Formula |
C36 H34 N O6 P |
| Calculated formula |
C36 H34 N O6 P |
| SMILES |
c12c(ccc3ccccc13)OP(=O)(Oc1c2c2ccccc2cc1)[O-].c1(ccccc1)[C@@H](O)[C@H](c1ccccc1)[NH3+].OCC |
| Title of publication |
Formation of supramolecular host system with multiple chiral points (central, axial, and helical) by using (1R,2S)-2-amino-1,2-diphenylethanol |
| Authors of publication |
Imai, Yoshitane; Murata, Katuzo; Matsuno, Hideki; Sato, Tomohiro; Kuroda, Reiko; Matsubara, Yoshio |
| Journal of publication |
CrystEngComm |
| Year of publication |
2008 |
| Journal volume |
10 |
| Journal issue |
8 |
| Pages of publication |
947 |
| a |
8.6165 ± 0.0004 Å |
| b |
14.8416 ± 0.0007 Å |
| c |
24.394 ± 0.0012 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3119.6 ± 0.3 Å3 |
| Cell temperature |
130 ± 2 K |
| Ambient diffraction temperature |
130 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0476 |
| Residual factor for significantly intense reflections |
0.0433 |
| Weighted residual factors for significantly intense reflections |
0.0991 |
| Weighted residual factors for all reflections included in the refinement |
0.1016 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7202062.html