Information card for entry 7202276
| Common name |
cis,cis-1,3,5-cyclohexanetricarboxylic acid - (4(3H)- pyrimidone)2 |
| Chemical name |
cis,cis-1,3,5-cyclohexanetricarboxylic acid - [4(3H)-pyrimidone]2 |
| Formula |
C17 H20 N4 O8 |
| Calculated formula |
C17 H20 N4 O8 |
| SMILES |
O=C(O)C1CC(C(=O)O)CC(C(=O)O)C1.[nH]1cnccc1=O.O=c1[nH]cncc1 |
| Title of publication |
Molecular networks. Design and serendipity |
| Authors of publication |
Bhogala, Balakrishna R.; Chandran, Sreekanth K.; Reddy, L. Sreenivas; Thakuria, Ranjit; Nangia, Ashwini |
| Journal of publication |
CrystEngComm |
| Year of publication |
2008 |
| Journal volume |
10 |
| Journal issue |
12 |
| Pages of publication |
1735 |
| a |
13.3218 ± 0.0014 Å |
| b |
5.7554 ± 0.0006 Å |
| c |
24.093 ± 0.003 Å |
| α |
90° |
| β |
90.508 ± 0.002° |
| γ |
90° |
| Cell volume |
1847.2 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0892 |
| Residual factor for significantly intense reflections |
0.0533 |
| Weighted residual factors for significantly intense reflections |
0.1216 |
| Weighted residual factors for all reflections included in the refinement |
0.1394 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.969 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7202276.html