Information card for entry 7203871
| Formula |
C16 H24 N2 |
| Calculated formula |
C16 H24 N2 |
| SMILES |
n1(n2c(c(c(c2C)C)C)C)c(c(c(c1C)C)C)C |
| Title of publication |
Synthesis, oxidation and protonation of octamethyl-1,1'-bipyrrole |
| Authors of publication |
Kuhn, Norbert; Kotowski, Heike; Steimann, Manfred; Speiser, Bernd; Würde, Marc; Henkel, Gerald |
| Journal of publication |
Journal of the Chemical Society, Perkin Transactions 2 |
| Year of publication |
2000 |
| Journal issue |
2 |
| Pages of publication |
353 |
| a |
8.4201 ± 0.0017 Å |
| b |
16.681 ± 0.003 Å |
| c |
21.656 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3041.7 ± 1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0645 |
| Residual factor for significantly intense reflections |
0.0366 |
| Weighted residual factors for significantly intense reflections |
0.093 |
| Weighted residual factors for all reflections included in the refinement |
0.1043 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.281 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7203871.html