Information card for entry 7204594
| Common name |
Trimethoprim p-toluenesulfonate |
| Chemical name |
[2,4-diamino-5-(3',4',5'-trimethoxybenzyl pyrimidinium)] 4-methylbenzene sulfonate |
| Formula |
C21 H26 N4 O6 S |
| Calculated formula |
C21 H26 N4 O6 S |
| SMILES |
c1([nH+]cc(c(n1)N)Cc1cc(c(c(c1)OC)OC)OC)N.c1(ccc(cc1)C)S(=O)(=O)[O-] |
| Title of publication |
Supramolecular organisation via hydrogen bonding in trimethoprim sulfonate salts |
| Authors of publication |
Baskar Raj, S.; Sethuraman, V.; Francis, S.; Hemamalini, M.; Muthiah, P. Thomas; Bocelli, G.; Cantoni, A.; Rychlewska, U.; Warzajtis, B. |
| Journal of publication |
CrystEngComm |
| Year of publication |
2003 |
| Journal volume |
5 |
| Journal issue |
15 |
| Pages of publication |
70 |
| a |
13.407 ± 0.003 Å |
| b |
10.039 ± 0.003 Å |
| c |
17.115 ± 0.007 Å |
| α |
90° |
| β |
90.6 ± 0.03° |
| γ |
90° |
| Cell volume |
2303.4 ± 1.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0681 |
| Residual factor for significantly intense reflections |
0.0412 |
| Weighted residual factors for significantly intense reflections |
0.1016 |
| Weighted residual factors for all reflections included in the refinement |
0.1158 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7204594.html