Information card for entry 7205284
| Common name |
N,N'-bis(2,3,4,5,6-pentafluorobenzylidene)-1,4- phenylenediamine |
| Chemical name |
N,N'-bis(2,3,4,5,6-pentafluorobenzylidene)-1,4-phenylenediamine |
| Formula |
C20 H6 F10 N2 |
| Calculated formula |
C20 H6 F10 N2 |
| SMILES |
c1(c(c(F)c(c(c1F)F)F)F)/C=N/c1ccc(cc1)/N=C/c1c(c(c(c(c1F)F)F)F)F |
| Title of publication |
Activation and de-activation of fluorine synthons by nitrogen substitution in fluorinated aza-distyrylbenzenes |
| Authors of publication |
Collas, Alain; De Borger, Roeland; Amanova, Tatyana; Blockhuys, Frank |
| Journal of publication |
CrystEngComm |
| Year of publication |
2011 |
| Journal volume |
13 |
| Journal issue |
2 |
| Pages of publication |
702 |
| a |
5.846 ± 0.002 Å |
| b |
7.929 ± 0.002 Å |
| c |
10.331 ± 0.003 Å |
| α |
109.78 ± 0.02° |
| β |
102.35 ± 0.03° |
| γ |
96.13 ± 0.03° |
| Cell volume |
431.7 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0701 |
| Residual factor for significantly intense reflections |
0.0562 |
| Weighted residual factors for significantly intense reflections |
0.1554 |
| Weighted residual factors for all reflections included in the refinement |
0.1696 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7205284.html
