Information card for entry 7206749
| Formula |
C20 H17 Cl N2 O4 |
| Calculated formula |
C20 H17 Cl N2 O4 |
| SMILES |
Cl(=O)(=O)(=O)[O-].[nH]1c2c([n+](c1c1ccccc1)Cc1ccccc1)cccc2 |
| Title of publication |
Nonlinear optical and ferroelectric materials based on 1-benzyl-2-phenyl-1H-benzimidazole salts |
| Authors of publication |
Wang, Yong-Tao; Tang, Gui-Mei; He, Chao; Yan, Shi-Chen; Hao, Qi-Chao; Chen, Long; Long, Xi-Fa; Li, Tian-Duo; Ng, Seik Weng |
| Journal of publication |
CrystEngComm |
| Year of publication |
2011 |
| Journal volume |
13 |
| Journal issue |
21 |
| Pages of publication |
6365 |
| a |
5.7108 ± 0.0017 Å |
| b |
9.011 ± 0.003 Å |
| c |
9.451 ± 0.003 Å |
| α |
70.55 ± 0.003° |
| β |
81.022 ± 0.004° |
| γ |
85.818 ± 0.003° |
| Cell volume |
452.9 ± 0.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
1 |
| Hermann-Mauguin space group symbol |
P 1 |
| Hall space group symbol |
P 1 |
| Residual factor for all reflections |
0.0386 |
| Residual factor for significantly intense reflections |
0.0333 |
| Weighted residual factors for significantly intense reflections |
0.0871 |
| Weighted residual factors for all reflections included in the refinement |
0.0908 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.059 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7206749.html
