Information card for entry 7207185
| Formula |
C34 H22 O4 S2 |
| Calculated formula |
C34 H22 O4 S2 |
| SMILES |
S(C1=C(C(=O)c2ccccc2C1=O)C)c1ccc(cc1)c1ccc(SC2=C(C(=O)c3ccccc3C2=O)C)cc1 |
| Title of publication |
Preparation of novel polymorphic pigment 3,3′-(4,4′-biphenyldiylbisthio)bis-2-methyl-1,4-naphthoquinone and its polymorphic properties |
| Authors of publication |
Kinuta, Takafumi; Sato, Tomohiro; Tajima, Nobuo; Matsubara, Yoshio; Miyazawa, Mitsuo; Imai, Yoshitane |
| Journal of publication |
CrystEngComm |
| Year of publication |
2012 |
| Journal volume |
14 |
| Journal issue |
3 |
| Pages of publication |
1016 |
| a |
6.869 ± 0.002 Å |
| b |
12.205 ± 0.005 Å |
| c |
15.661 ± 0.005 Å |
| α |
88.608 ± 0.009° |
| β |
78.867 ± 0.01° |
| γ |
85.617 ± 0.008° |
| Cell volume |
1284.4 ± 0.8 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0636 |
| Residual factor for significantly intense reflections |
0.0524 |
| Weighted residual factors for significantly intense reflections |
0.1358 |
| Weighted residual factors for all reflections included in the refinement |
0.1449 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7207185.html