Information card for entry 7207903
| Formula |
C16 H16 N6 O2 |
| Calculated formula |
C16 H16 N6 O2 |
| SMILES |
O=C(Nc1c(NC(=O)c2nccn2C)cccc1)c1nccn1C |
| Title of publication |
Light-triggered NO release from a nanofibrous non-woven |
| Authors of publication |
Bohlender, Carmen; Wolfram, Martin; Goerls, Helmar; Imhof, Wolfgang; Menzel, Roberto; Baumgaertel, Anja; Schubert, Ulrich S.; Mueller, Ulrike; Frigge, Martina; Schnabelrauch, Matthias; Wyrwa, Ralf; Schiller, Alexander |
| Journal of publication |
Journal of Materials Chemistry |
| Year of publication |
2012 |
| Journal volume |
22 |
| Journal issue |
18 |
| Pages of publication |
8785 |
| a |
11.4171 ± 0.0007 Å |
| b |
11.8541 ± 0.0009 Å |
| c |
12.1504 ± 0.0009 Å |
| α |
81.797 ± 0.004° |
| β |
73.957 ± 0.005° |
| γ |
75.363 ± 0.005° |
| Cell volume |
1524.4 ± 0.19 Å3 |
| Cell temperature |
133 ± 2 K |
| Ambient diffraction temperature |
133 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.123 |
| Residual factor for significantly intense reflections |
0.0538 |
| Weighted residual factors for significantly intense reflections |
0.1061 |
| Weighted residual factors for all reflections included in the refinement |
0.1295 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.957 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7207903.html
