Information card for entry 7208699
| Formula |
C14 H8 Li2 O5 |
| Calculated formula |
C14 H8 Li2 O5 |
| SMILES |
C(=O)(c1ccc(cc1)Oc1ccc(C(=O)[O-])cc1)[O-].[Li+].[Li+] |
| Title of publication |
Synthesis, structures, and properties of alkali and alkaline earth coordination polymers based on V-shaped ligand |
| Authors of publication |
Cheng, P.-C.; Tseng, F.-S.; Yeh, C.-T.; Chang, T.-G.; Kao, C.-C.; Lin, C.-H.; Liu, W.-R.; Chen, J.-S.; Zima, V. |
| Journal of publication |
CrystEngComm |
| Year of publication |
2012 |
| Journal volume |
14 |
| Journal issue |
20 |
| Pages of publication |
6812 |
| a |
8.4363 ± 0.0004 Å |
| b |
5.3754 ± 0.0002 Å |
| c |
25.8792 ± 0.0012 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1173.58 ± 0.09 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
60 |
| Hermann-Mauguin space group symbol |
P b c n |
| Hall space group symbol |
-P 2n 2ab |
| Residual factor for all reflections |
0.0618 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for significantly intense reflections |
0.0819 |
| Weighted residual factors for all reflections included in the refinement |
0.0884 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.018 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7208699.html