Information card for entry 7212344
| Common name |
3-Ethoxycarbonyl-2-phenyl-1,5-dihydro-4,1-benzothiazepine |
| Chemical name |
3-Ethoxycarbonyl-2-phenyl-1,5-dihydro-4,1-benzothiazepine |
| Formula |
C18 H17 N O2 S |
| Calculated formula |
C18 H17 N O2 S |
| SMILES |
C1SC(=C(Nc2ccccc12)c1ccccc1)C(=O)OCC |
| Title of publication |
Annular desmotropy of three pairs of seven-membered heterocycles confirmed by X-ray crystallography |
| Authors of publication |
Holczbauer, Tamás; Fábián, László; Csomós, Péter; Fodor, Lajos; Kálmán, Alajos |
| Journal of publication |
CrystEngComm |
| Year of publication |
2010 |
| Journal volume |
12 |
| Journal issue |
6 |
| Pages of publication |
1712 |
| a |
5.905 ± 0.002 Å |
| b |
7.947 ± 0.004 Å |
| c |
16.797 ± 0.009 Å |
| α |
90° |
| β |
97.611 ± 0.015° |
| γ |
90° |
| Cell volume |
781.3 ± 0.6 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0622 |
| Residual factor for significantly intense reflections |
0.0454 |
| Weighted residual factors for significantly intense reflections |
0.0818 |
| Weighted residual factors for all reflections included in the refinement |
0.0874 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.076 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7212344.html