Information card for entry 7214756
| Formula |
C30 H18 F4 |
| Calculated formula |
C30 H18 F4 |
| SMILES |
c1c(F)cc(cc1/C=C/c1c2ccccc2c(/C=C/c2cc(cc(c2)F)F)c2ccccc12)F |
| Title of publication |
Supramolecular interactions induced fluorescent organic nanowires with high quantum yield based on 9,10-distyrylanthracene |
| Authors of publication |
Dong, Yujie; Xu, Bin; Zhang, Jibo; Lu, Hongguang; Wen, Shanpeng; Chen, Feipeng; He, Jiating; Li, Bao; Ye, Ling; Tian, Wenjing |
| Journal of publication |
CrystEngComm |
| Year of publication |
2012 |
| Journal volume |
14 |
| Journal issue |
20 |
| Pages of publication |
6593 |
| a |
4.0152 ± 0.0008 Å |
| b |
9.821 ± 0.002 Å |
| c |
13.736 ± 0.003 Å |
| α |
78.74 ± 0.03° |
| β |
86.02 ± 0.03° |
| γ |
84.26 ± 0.03° |
| Cell volume |
527.9 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1147 |
| Residual factor for significantly intense reflections |
0.061 |
| Weighted residual factors for significantly intense reflections |
0.1623 |
| Weighted residual factors for all reflections included in the refinement |
0.1885 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.077 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7214756.html
