Information card for entry 7219044
| Chemical name |
E,E-N3,N3'-Bis(2-pyridylmethylene)-(2,2'-bipyridine)-3,3'-diamine |
| Formula |
C22 H16 N6 |
| Calculated formula |
C22 H16 N6 |
| SMILES |
n1cccc(/N=C/c2ncccc2)c1c1ncccc1/N=C/c1ncccc1 |
| Title of publication |
Probing the reactivity of a 2,2′-bipyridyl-3,3′-bis-imine ligand by X-ray crystallography |
| Authors of publication |
Wang, Jian; Hayward, John J.; Gumbau-Brisa, Roger; Wallis, John D.; Stoeckli-Evans, Helen; Pilkington, Melanie |
| Journal of publication |
CrystEngComm |
| Year of publication |
2015 |
| Journal volume |
17 |
| Journal issue |
5 |
| Pages of publication |
1159 |
| a |
10.9614 ± 0.0006 Å |
| b |
20.1743 ± 0.0011 Å |
| c |
8.7356 ± 0.0005 Å |
| α |
90° |
| β |
101.49 ± 0.003° |
| γ |
90° |
| Cell volume |
1893.06 ± 0.18 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0869 |
| Residual factor for significantly intense reflections |
0.0529 |
| Weighted residual factors for significantly intense reflections |
0.0994 |
| Weighted residual factors for all reflections included in the refinement |
0.111 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.098 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7219044.html