Information card for entry 7219303
| Formula |
C14 H11 N5 |
| Calculated formula |
C14 H11 N5 |
| SMILES |
c1cccc(c2nnc(c3ccc(cc3)C)nn2)n1 |
| Title of publication |
Novel 3,6-Unsymmetrically Disubstituted-1,2,4,5-Tetrazines: S-Induced One-Pot Synthesis, Properties and Theoretical Study |
| Authors of publication |
Li, chen; Ge, Haixia; Yin, Bing; She, Mengyao; Liu, Ping; Li, Xiangdong; Li, Jianli |
| Journal of publication |
RSC Adv. |
| Year of publication |
2015 |
| a |
11.781 ± 0.004 Å |
| b |
8.473 ± 0.003 Å |
| c |
24.554 ± 0.009 Å |
| α |
90° |
| β |
91.214 ± 0.006° |
| γ |
90° |
| Cell volume |
2450.4 ± 1.5 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0714 |
| Residual factor for significantly intense reflections |
0.0466 |
| Weighted residual factors for significantly intense reflections |
0.129 |
| Weighted residual factors for all reflections included in the refinement |
0.1507 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7219303.html