Information card for entry 7220085
| Common name |
2-amino-8a-methoxy-6,7,8,8a-tetrahydro-4H-chromene-3,4,4(4aH,5H)-tricarbonitrile |
| Chemical name |
2-amino-8a-methoxy-6,7,8,8a-tetrahydro-4H-chromene-3,4,4(4aH,5H)-tricarbonitrile |
| Formula |
C12 H13 N3 O2 |
| Calculated formula |
C12 H13 N3 O2 |
| SMILES |
O1C(=C(C(=C2CCCCC12OC)C#N)C#N)N |
| Title of publication |
Domino-Synthesis and Fluorescent Properties of 4-cyano-2-oxo-1,2-dihydropyridine-3-carboxamides and 2-oxo-1,2-dihydropyridine-3,4-dicarbonitriles |
| Authors of publication |
Ershov, Oleg V.; Fedoseev, Sergey V.; Belikov, Mikhail Yu; Ievlev, Mikhail Yu |
| Journal of publication |
RSC Adv. |
| Year of publication |
2015 |
| a |
8.1414 ± 0.0006 Å |
| b |
8.9768 ± 0.0007 Å |
| c |
8.9788 ± 0.0007 Å |
| α |
75.259 ± 0.001° |
| β |
87.305 ± 0.001° |
| γ |
65.104 ± 0.001° |
| Cell volume |
574.28 ± 0.08 Å3 |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.039 |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7220085.html