Information card for entry 7220089
| Formula |
C24 H21 F N2 O3 |
| Calculated formula |
C24 H21 F N2 O3 |
| SMILES |
Fc1ccc(C2N(N3C=Cc4c(C3=CC=C2C(=O)OCC)cccc4)C(=O)C)cc1 |
| Title of publication |
Phosphine-catalyzed [4 + 3] Cycloaddition Reaction of Aromatic Azomethine Imines with Allenoates |
| Authors of publication |
Guo, Hongchao; Li, Zhen; Yu, Hao; Feng, Yalin; Hou, Zhanfeng; Zhang, Lei; Yang, Wenjun; Wu, Yang; Xiao, Yumei |
| Journal of publication |
RSC Adv. |
| Year of publication |
2015 |
| a |
8.5283 ± 0.0017 Å |
| b |
11.326 ± 0.002 Å |
| c |
11.349 ± 0.002 Å |
| α |
112.58 ± 0.03° |
| β |
97.17 ± 0.03° |
| γ |
97.42 ± 0.03° |
| Cell volume |
985.3 ± 0.4 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0689 |
| Residual factor for significantly intense reflections |
0.0596 |
| Weighted residual factors for significantly intense reflections |
0.1294 |
| Weighted residual factors for all reflections included in the refinement |
0.1349 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.121 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7220089.html
