Information card for entry 7220589
| Formula |
C7 H9 N O7 Pt |
| Calculated formula |
C7 H9 N O7 Pt |
| SMILES |
[Pt]1(OC(=O)c2[n]1cccc2C(=O)[O-])([OH2])[OH2].O |
| Title of publication |
Synthesis, characterization, and DNA interaction of novel Pt(ii) complexes and their cytotoxicity, apoptosis and molecular docking |
| Authors of publication |
Zhu, Ming-Chang; Cui, Xiao-Ting; Zhao, Fu-Chen; Ma, Xiao-Yu; Han, Zheng-Bo; Gao, En-Jun |
| Journal of publication |
RSC Adv. |
| Year of publication |
2015 |
| Journal volume |
5 |
| Journal issue |
59 |
| Pages of publication |
47798 |
| a |
7.6445 ± 0.0017 Å |
| b |
18.415 ± 0.004 Å |
| c |
7.137 ± 0.0016 Å |
| α |
90° |
| β |
96.371 ± 0.003° |
| γ |
90° |
| Cell volume |
998.5 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0253 |
| Residual factor for significantly intense reflections |
0.0217 |
| Weighted residual factors for significantly intense reflections |
0.0536 |
| Weighted residual factors for all reflections included in the refinement |
0.0555 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7220589.html