Information card for entry 7220754
| Formula |
C26 H29 N O6 |
| Calculated formula |
C26 H29 N O6 |
| SMILES |
O(CC1c2ccccc2c2ccccc12)C(=O)N[C@H](C(=O)O)Cc1ccccc1.OC.OC |
| Title of publication |
Hydrogels formed from Fmoc amino acids |
| Authors of publication |
Draper, Emily R.; Morris, Kyle L.; Little, Marc A.; Raeburn, Jaclyn; Colquhoun, Catherine; Cross, Emily R.; McDonald, Tom. O.; Serpell, Louise C.; Adams, Dave J. |
| Journal of publication |
CrystEngComm |
| Year of publication |
2015 |
| Journal volume |
17 |
| Journal issue |
42 |
| Pages of publication |
8047 |
| a |
13.076 ± 0.006 Å |
| b |
4.887 ± 0.002 Å |
| c |
18.998 ± 0.009 Å |
| α |
90° |
| β |
106.417 ± 0.011° |
| γ |
90° |
| Cell volume |
1164.5 ± 0.9 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.1548 |
| Residual factor for significantly intense reflections |
0.1269 |
| Weighted residual factors for significantly intense reflections |
0.3191 |
| Weighted residual factors for all reflections included in the refinement |
0.3389 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.141 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7220754.html
