Information card for entry 7220790
| Formula |
C30 H38 O6 |
| Calculated formula |
C30 H38 O6 |
| SMILES |
O1[C@@H]2CC[C@]3(O[C@@H]3C[C@H]3[C@@H](OC(=O)[C@@]43[C@@]3(C[C@@H](C5=C3C[C@H]3[C@@H](OC(=O)C3=C)C[C@@H]5C)C4)C)C[C@@]12C)C |
| Title of publication |
Cytotoxic 2, 4-Linked Sesquiterpene Lactone Dimers from Carpesium faberi Exhibiting NF-κB Inhibitory Activity |
| Authors of publication |
Yang, Yong-xun; Gao, Shuang; Zhang, Shoude; Zu, Xian-peng; Shen, Yunheng; Shan, Lei; Li, Hui-Liang; Zhang, Weidong |
| Journal of publication |
RSC Adv. |
| Year of publication |
2015 |
| a |
7.6885 ± 0.0002 Å |
| b |
19.3149 ± 0.0004 Å |
| c |
40.8677 ± 0.0009 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
6069 ± 0.2 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.073 |
| Residual factor for significantly intense reflections |
0.0551 |
| Weighted residual factors for significantly intense reflections |
0.1665 |
| Weighted residual factors for all reflections included in the refinement |
0.1882 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.761 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7220790.html