Information card for entry 7223722
| Chemical name |
N,N,N',N'-tetramethylguanidinium naphthalaldehydate,(Me2N)2CNH2.15 |
| Formula |
C17 H21 N3 O3 |
| Calculated formula |
C17 H21 N3 O3 |
| SMILES |
O=C([O-])c1cccc2cccc(c12)C=O.N(C(=[NH2+])N(C)C)(C)C |
| Title of publication |
Two modes of peri-interaction between an aldehyde group and a carboxylate anion in naphthalaldehydate salts |
| Authors of publication |
Saritemur, Gizem; Nomen Miralles, Laura; Husson, Deborah; Pitak, Mateusz B.; Coles, Simon J.; Wallis, John D. |
| Journal of publication |
CrystEngComm |
| Year of publication |
2016 |
| Journal volume |
18 |
| Journal issue |
6 |
| Pages of publication |
948 |
| a |
9.0149 ± 0.0005 Å |
| b |
9.7808 ± 0.0005 Å |
| c |
18.7439 ± 0.0011 Å |
| α |
90° |
| β |
102.981 ± 0.005° |
| γ |
90° |
| Cell volume |
1610.47 ± 0.16 Å3 |
| Cell temperature |
110 ± 2 K |
| Ambient diffraction temperature |
110 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0691 |
| Residual factor for significantly intense reflections |
0.0527 |
| Weighted residual factors for significantly intense reflections |
0.1008 |
| Weighted residual factors for all reflections included in the refinement |
0.1069 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.154 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7223722.html