Information card for entry 7224025
| Chemical name |
E,E-N3,N3'-Bis(2-hydroxybenzylidene)-(2,2'-bipyridine)-3,3'-diamine |
| Formula |
C24 H18 N4 O2 |
| Calculated formula |
C24 H18 N4 O2 |
| SMILES |
n1cccc(/N=C/c2c(O)cccc2)c1c1ncccc1/N=C/c1c(O)cccc1 |
| Title of publication |
Structural insights into the coordination chemistry and reactivity of a 3,3′-bis-imine-2,2′-bipyridine ligand |
| Authors of publication |
Gumbau-Brisa, R.; Hayward, J. J.; Wallis, J. D.; Rawson, J. M.; Pilkington, M. |
| Journal of publication |
CrystEngComm |
| Year of publication |
2016 |
| Journal volume |
18 |
| Journal issue |
11 |
| Pages of publication |
1892 |
| a |
8.2616 ± 0.0005 Å |
| b |
11.0442 ± 0.0007 Å |
| c |
11.8712 ± 0.0007 Å |
| α |
69.313 ± 0.004° |
| β |
76.743 ± 0.004° |
| γ |
71.691 ± 0.004° |
| Cell volume |
953.45 ± 0.11 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0836 |
| Residual factor for significantly intense reflections |
0.0518 |
| Weighted residual factors for significantly intense reflections |
0.1435 |
| Weighted residual factors for all reflections included in the refinement |
0.1585 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.376 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7224025.html
