Information card for entry 7224645
| Chemical name |
2-(4-isocyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| Formula |
C13 H16 B N O2 |
| Calculated formula |
C13 H16 B N O2 |
| SMILES |
[C]#[N]c1ccc(B2OC(C(C)(C)O2)(C)C)cc1 |
| Title of publication |
Synthesis and Stability Study of Isocyano Aryl Boronate Esters and their Synthetic Applications |
| Authors of publication |
Fang, Hao-Ping; Fu, Chia-Chieh; Tai, Chin-Kuen; Chang, Ken-Hao; Yang, Ru-Han; Wu, Meng-Ju; Chen, Hsien-Chi; Li, Chia-Jung; Huang, Shi-Qing; Lien, Wan-Hsiang; Chen, Chih-Hsin; Hsieh, Chung-Hung; Wang, Bo-Cheng; Cheung, Siu-Fung; Pan, PoShen |
| Journal of publication |
RSC Adv. |
| Year of publication |
2016 |
| a |
11.0964 ± 0.0005 Å |
| b |
13.2916 ± 0.0006 Å |
| c |
10.4278 ± 0.0007 Å |
| α |
90° |
| β |
119.655 ± 0.002° |
| γ |
90° |
| Cell volume |
1336.54 ± 0.13 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0453 |
| Residual factor for significantly intense reflections |
0.0372 |
| Weighted residual factors for significantly intense reflections |
0.0925 |
| Weighted residual factors for all reflections included in the refinement |
0.0996 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.022 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7224645.html