Information card for entry 7224823
| Formula |
C18 H14 Cu N4 O6 |
| Calculated formula |
C18 H14 Cu N4 O6 |
| SMILES |
[Cu]123(OC(=N[N]2=Cc2cccc4ccc[n]3c24)c2cccc(OC)c2O)ON(=O)=[O]1 |
| Title of publication |
Two hydrazone Copper (II) complexes: Synthesis, crystal structure, cytotoxicity, and action mechanism |
| Authors of publication |
hu, kun; Zhou, Guimei; Zhang, Zhong; Li, Jingui; Li, Feiyan; Liang, Fupei |
| Journal of publication |
RSC Adv. |
| Year of publication |
2016 |
| a |
6.9484 ± 0.0011 Å |
| b |
15.176 ± 0.002 Å |
| c |
16.475 ± 0.002 Å |
| α |
90.222 ± 0.011° |
| β |
90.699 ± 0.012° |
| γ |
91.171 ± 0.012° |
| Cell volume |
1736.8 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1507 |
| Residual factor for significantly intense reflections |
0.0861 |
| Weighted residual factors for significantly intense reflections |
0.1625 |
| Weighted residual factors for all reflections included in the refinement |
0.1925 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.08 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7224823.html
