Information card for entry 7225293
| Chemical name |
ciclesonide methanol solvate |
| Formula |
C33 H48 O8 |
| Calculated formula |
C33 H48 O8 |
| SMILES |
O=C1C=C2[C@@](C=C1)(C)[C@@H]1[C@@H](CC2)[C@H]2[C@@](C[C@@H]1O)(C)[C@@]1(O[C@@H](O[C@@H]1C2)C1CCCCC1)C(=O)COC(=O)C(C)C.OC |
| Title of publication |
Crystal structure, thermal crystal form transformation, desolvation process and desolvation kinetics of two novel solvates of ciclesonide |
| Authors of publication |
Zhou, Li na; Yin, Qiuxiang; Du, Shichao; Hao, Hongxun; Li, Yanfeng; Mingyan, Liu; Hou, Baohong |
| Journal of publication |
RSC Adv. |
| Year of publication |
2016 |
| a |
11.0007 ± 0.0011 Å |
| b |
11.0007 ± 0.0011 Å |
| c |
25.559 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3093 ± 0.7 Å3 |
| Cell temperature |
386 ± 2 K |
| Ambient diffraction temperature |
386 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
78 |
| Hermann-Mauguin space group symbol |
P 43 |
| Hall space group symbol |
P 4cw |
| Residual factor for all reflections |
0.0343 |
| Residual factor for significantly intense reflections |
0.0323 |
| Weighted residual factors for significantly intense reflections |
0.1011 |
| Weighted residual factors for all reflections included in the refinement |
0.1034 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.024 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7225293.html