Information card for entry 7225517
| Formula |
C27 H19 N3 O2 |
| Calculated formula |
C27 H19 N3 O2 |
| SMILES |
N(c1ccccc1)(c1ccc(/C=C(c2ccc(N(=O)=O)cc2)\C#N)cc1)c1ccccc1 |
| Title of publication |
Branched Triphenylamine-cored Compounds: Aggregation Induced Two-photon Absorption |
| Authors of publication |
Zhang, Xin; Gan, Xiaoping; Yao, Shun; Zhu, Weiju; Yu, Jianhua; Wu, Zhichao; zhou, Hongping; Tian, Yupeng; Wu, Jieying |
| Journal of publication |
RSC Adv. |
| Year of publication |
2016 |
| a |
11.165 ± 0.005 Å |
| b |
7.545 ± 0.005 Å |
| c |
25.708 ± 0.005 Å |
| α |
90 ± 0.005° |
| β |
96.505 ± 0.005° |
| γ |
90 ± 0.005° |
| Cell volume |
2151.7 ± 1.8 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0731 |
| Residual factor for significantly intense reflections |
0.0454 |
| Weighted residual factors for significantly intense reflections |
0.1296 |
| Weighted residual factors for all reflections included in the refinement |
0.1559 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7225517.html