Information card for entry 7226353
| Chemical name |
Lecanicillone A |
| Formula |
C28 H32 O6 |
| Calculated formula |
C28 H32 O6 |
| SMILES |
o1c(c(c(=O)c2[C@H]3[C@@H]4c5c(=O)c(c(oc5[C@@](C)(CC)C(=O)[C@@H]4[C@H]3C(=O)[C@@](c12)(CC)C)C)C)C)C |
| Title of publication |
Lecanicillones A–C, Three Dimeric Isomers of Spiciferone A with Cyclobutane Ring from an Entomopathogenic Fungus Lecanicillium sp. PR-M-3 |
| Authors of publication |
Wang, Zai-ying; Sang, Xia-Nan; Sun, Ke; Huang, Sheng-dong; Chen, Sheng-shuang; Xue, Chunmei; Ban, Lanfeng; Li, Zhanlin; Hua, Huiming; Pei, Yuehu; Bai, Jiao |
| Journal of publication |
RSC Adv. |
| Year of publication |
2016 |
| a |
12.0422 ± 0.0002 Å |
| b |
6.75793 ± 0.00012 Å |
| c |
15.1547 ± 0.0003 Å |
| α |
90° |
| β |
103.445 ± 0.0019° |
| γ |
90° |
| Cell volume |
1199.49 ± 0.04 Å3 |
| Cell temperature |
99.5 K |
| Ambient diffraction temperature |
99.5 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0345 |
| Residual factor for significantly intense reflections |
0.0339 |
| Weighted residual factors for significantly intense reflections |
0.0889 |
| Weighted residual factors for all reflections included in the refinement |
0.0896 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7226353.html