Information card for entry 7226439
| Chemical name |
1,4-diamino-3,6-dinitropyrazolo[4,3-c]pyrazole |
| Formula |
C4 H4 N8 O4 |
| Calculated formula |
C4 H4 N8 O4 |
| SMILES |
c1(N(=O)=O)nn(N)c2c(N(=O)=O)nn(c12)N |
| Title of publication |
Synthesis, structure and properties of neutral energetic materials based on N-functionalization of 3,6-dinitropyrazolo[4,3-c]pyrazole |
| Authors of publication |
Li, Yanan; Shu, Yuan-jie; Wang, Bozhou; Zhang, Shengyong; Zhai, Lian-jie |
| Journal of publication |
RSC Adv. |
| Year of publication |
2016 |
| a |
9.082 ± 0.002 Å |
| b |
5.4849 ± 0.0013 Å |
| c |
16.575 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
825.7 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0307 |
| Residual factor for significantly intense reflections |
0.0291 |
| Weighted residual factors for significantly intense reflections |
0.0816 |
| Weighted residual factors for all reflections included in the refinement |
0.0834 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.049 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7226439.html