Information card for entry 7226492
| Formula |
C17 H13 Br N2 O2 |
| Calculated formula |
C17 H13 Br N2 O2 |
| SMILES |
BrC1=C(NCCc2ncccc2)C(=O)c2ccccc2C1=O |
| Title of publication |
Bromine substituted aminonaphthoquinones: Synthesis, Characterization, DFT and metal ion binding studies† |
| Authors of publication |
Salunke-Gawali, Sunita; Agarwal, Gunjan; Lande, Deepali N.; Chakravarty, Debamitra; Gejji, Shridhar P.; Patil, Amit Shrinivas; Gosavi, Prajkta |
| Journal of publication |
RSC Adv. |
| Year of publication |
2016 |
| a |
25.2419 ± 0.0004 Å |
| b |
4.4686 ± 0.0001 Å |
| c |
27.7323 ± 0.0004 Å |
| α |
90° |
| β |
108.09 ± 0.0008° |
| γ |
90° |
| Cell volume |
2973.47 ± 0.09 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0768 |
| Residual factor for significantly intense reflections |
0.0524 |
| Weighted residual factors for significantly intense reflections |
0.0846 |
| Weighted residual factors for all reflections included in the refinement |
0.0886 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.651 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7226492.html