Information card for entry 7228605
| Formula |
C33 H40 O4 |
| Calculated formula |
C33 H40 O4 |
| SMILES |
O=C1[C@@]2(C(=O)[C@@]34C(=O)[C@@]1(C(=O)c1ccccc1)C([C@H](C2)C[C@@H]4C(C)(C)[C@H](C3)C(=C)C)(C)C)CC=C(C)C |
| Title of publication |
Norsampsone E, an unprecedented decarbonyl polycyclic polyprenylated acylphloroglucinol with a homoadamantyl core from Hypericum sampsonii |
| Authors of publication |
Tian, Wen-Jing; Qiu, Yu-Qin; Chen, Jun-Jie; Yao, Xiao-Jun; Wang, Guang-Hui; Dai, Yi; Chen, Hai-Feng; Yao, Xin-Sheng |
| Journal of publication |
RSC Adv. |
| Year of publication |
2017 |
| Journal volume |
7 |
| Journal issue |
53 |
| Pages of publication |
33113 |
| a |
7.7835 ± 0.0006 Å |
| b |
12.1558 ± 0.0008 Å |
| c |
28.405 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2687.5 ± 0.4 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.1367 |
| Residual factor for significantly intense reflections |
0.0977 |
| Weighted residual factors for significantly intense reflections |
0.2371 |
| Weighted residual factors for all reflections included in the refinement |
0.275 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.069 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7228605.html