Information card for entry 7228892
| Chemical name |
3,7,9-tris[(trifluoromethyl)sulfonyl]-3,7,9-triazabicyclo[3.3.1]nonane |
| Formula |
C9 H10 F9 N3 O6 S3 |
| Calculated formula |
C9 H10 F9 N3 O6 S3 |
| SMILES |
S(=O)(=O)(N1CC2CN(S(=O)(=O)C(F)(F)F)CC(C1)N2S(=O)(=O)C(F)(F)F)C(F)(F)F |
| Title of publication |
Oxidative addition/cycloaddition of arenesulfonamides and triflamide to N-allyltriflamide and N,N-diallyltriflamide |
| Authors of publication |
Shainyan, B. A.; Astakhova, V. V.; Ganin, A. S.; Moskalik, M. Yu; Sterkhova, I. V. |
| Journal of publication |
RSC Adv. |
| Year of publication |
2017 |
| Journal volume |
7 |
| Journal issue |
62 |
| Pages of publication |
38951 |
| a |
11.214 ± 0.004 Å |
| b |
11.857 ± 0.005 Å |
| c |
14.874 ± 0.007 Å |
| α |
73.267 ± 0.014° |
| β |
78.954 ± 0.014° |
| γ |
80.979 ± 0.014° |
| Cell volume |
1848 ± 1.4 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1164 |
| Residual factor for significantly intense reflections |
0.0792 |
| Weighted residual factors for significantly intense reflections |
0.2262 |
| Weighted residual factors for all reflections included in the refinement |
0.2648 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7228892.html