Information card for entry 7242199
| Formula |
C14 H16 N6 O4 |
| Calculated formula |
C14 H16 N6 O4 |
| SMILES |
O=C([O-])c1ccc2cc(O)ccc2c1.O.[nH+]1c(nc(nc1N)N)N |
| Title of publication |
Supramolecular salts assembled by melamine and two organic hydroxyl acids: synthesis, structure, hydrogen bonds, and luminescent property |
| Authors of publication |
Li, Fengcai; Xu, Hao; Xu, Xinwei; Cang, Hui; Xu, Jiaying; Chen, Song |
| Journal of publication |
CrystEngComm |
| Year of publication |
2021 |
| Journal volume |
23 |
| Journal issue |
11 |
| Pages of publication |
2235 - 2248 |
| a |
35.3301 ± 0.0011 Å |
| b |
10.8822 ± 0.0003 Å |
| c |
7.5873 ± 0.0002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2917.08 ± 0.14 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
60 |
| Hermann-Mauguin space group symbol |
P b c n |
| Hall space group symbol |
-P 2n 2ab |
| Residual factor for all reflections |
0.0743 |
| Residual factor for significantly intense reflections |
0.0467 |
| Weighted residual factors for significantly intense reflections |
0.0941 |
| Weighted residual factors for all reflections included in the refinement |
0.1078 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.077 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7242199.html
