Information card for entry 7704280
| Formula |
C32 H36 N4 O4 Zn |
| Calculated formula |
C32 H36 N4 O4 Zn |
| SMILES |
[Zn]123(Oc4c(C(C)(C)C)cccc4C=[N]2c2c([N]3=Cc3c(O1)c(ccc3)C(C)(C)C)cc(c(c2)C#N)C#N)[OH]C.OC |
| Title of publication |
Crystal structures, red-shifted luminescence and iodide-anion recognition properties of four novel D-A type Zn(ii) complexes. |
| Authors of publication |
Song, Jian-Biao; Wang, Pengfei; Yan, Li; Hao, Liang; Khan, Maroof Ahmad; Liu, Gui-Lei; Li, Hui |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2020 |
| Journal volume |
49 |
| Journal issue |
14 |
| Pages of publication |
4358 - 4368 |
| a |
7.3811 ± 0.0013 Å |
| b |
13.9023 ± 0.0018 Å |
| c |
16.664 ± 0.002 Å |
| α |
99.06 ± 0.03° |
| β |
102.13 ± 0.02° |
| γ |
104.723 ± 0.018° |
| Cell volume |
1576.2 ± 0.5 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.2595 |
| Residual factor for significantly intense reflections |
0.1108 |
| Weighted residual factors for significantly intense reflections |
0.1782 |
| Weighted residual factors for all reflections included in the refinement |
0.2209 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.101 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7704280.html