Information card for entry 7705385
| Formula |
C18 H26 F12 N2 O5 |
| Calculated formula |
C18 H26 F12 N2 O5 |
| SMILES |
N1(CCOCCOCCN(CCOCC1)CC(O)(C(F)(F)F)C(F)(F)F)CC(O)(C(F)(F)F)C(F)(F)F |
| Title of publication |
Alkaline-earth complexes with macrocyclic-functionalised bis(phenolate)s and bis(fluoroalkoxide)s. |
| Authors of publication |
Hammoud, Joanna; Abou-Khalil, Fatima; Roisnel, Thierry; Dorcet, Vincent; Bour, Christophe; Gandon, Vincent; Lebœuf, David; Carpentier, Jean-François; Sarazin, Yann |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2020 |
| Journal volume |
49 |
| Journal issue |
37 |
| Pages of publication |
13017 - 13028 |
| a |
6.6356 ± 0.0008 Å |
| b |
12.769 ± 0.0014 Å |
| c |
15.2327 ± 0.0015 Å |
| α |
68.157 ± 0.003° |
| β |
84.686 ± 0.003° |
| γ |
83.583 ± 0.004° |
| Cell volume |
1188.7 ± 0.2 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0624 |
| Residual factor for significantly intense reflections |
0.0509 |
| Weighted residual factors for significantly intense reflections |
0.1306 |
| Weighted residual factors for all reflections included in the refinement |
0.1394 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7705385.html
