Information card for entry 7708558
| Formula |
C23 H28 Ag Cl N2 |
| Calculated formula |
C23 H28 Ag Cl N2 |
| SMILES |
[Ag](Cl)=C1N(c2cc(C)c(C)cc2N1Cc1c(C)c(C)cc(C)c1C)CC=C |
| Title of publication |
Synthesis, characterization, antimicrobial and antibiofilm activity, and molecular docking analysis of NHC precursors and their Ag-NHC complexes |
| Authors of publication |
Üstün, Elvan; Şahin, Neslihan; Çelik, Cem; Tutar, Uğur; Özdemir, Namık; Gürbüz, Nevin; Özdemir, İsmail |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2021 |
| a |
10.1252 ± 0.0006 Å |
| b |
10.6418 ± 0.0006 Å |
| c |
11.6214 ± 0.0007 Å |
| α |
90.879 ± 0.005° |
| β |
104.275 ± 0.005° |
| γ |
115.012 ± 0.004° |
| Cell volume |
1089.49 ± 0.12 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0319 |
| Residual factor for significantly intense reflections |
0.0267 |
| Weighted residual factors for significantly intense reflections |
0.0697 |
| Weighted residual factors for all reflections included in the refinement |
0.0725 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7708558.html
