Information card for entry 7714373
| Formula |
C6 H8 Cu N18 O2 |
| Calculated formula |
C6 H8 Cu N18 O2 |
| SMILES |
[Cu]12([n]3c(nc(nc3Nc3n2nnn3)Nc2[nH]nnn2)Nc2n1nnn2)([OH2])[OH2] |
| Title of publication |
In situ growth of copper-based energetic complexes on GO and MXene to synergistically promote the thermal decomposition of ammonium perchlorate |
| Authors of publication |
Li, Shuting; Li, Min; Han, Jinxi; Xia, Zhengqiang; Chen, Sanping; Xie, Gang; Gao, Sheng-Li; Lu, Jack; Yang, Qi |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2023 |
| a |
6.883 ± 0.0018 Å |
| b |
9.131 ± 0.003 Å |
| c |
12.186 ± 0.003 Å |
| α |
101.122 ± 0.004° |
| β |
103.119 ± 0.005° |
| γ |
106.744 ± 0.004° |
| Cell volume |
686.3 ± 0.3 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296.15 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0703 |
| Residual factor for significantly intense reflections |
0.0459 |
| Weighted residual factors for significantly intense reflections |
0.0967 |
| Weighted residual factors for all reflections included in the refinement |
0.1057 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7714373.html
