Information card for entry 8000476
| Formula |
C36 H32 N4 O |
| Calculated formula |
C36 H32 N4 O |
| SMILES |
O(c1c(c(cc2c(c(nc(N3CCCCC3)c12)C)c1ccc2n(c3c(c2c1)cccc3)c1ccccc1)C)C#N)C |
| Title of publication |
Excitation-Dependent Triplet-Singlet Intensity from Organic Host-Guest Materials: Tunable Color, White-Light Emission, and Room-Temperature Phosphorescence. |
| Authors of publication |
Wang, Dan; Xie, Yufeng; Wu, Xinghui; Lei, Yunxiang; Zhou, Yunbing; Cai, Zhengxu; Liu, Miaochang; Wu, Huayue; Huang, Xiaobo; Dong, Yuping |
| Journal of publication |
The journal of physical chemistry letters |
| Year of publication |
2021 |
| Journal volume |
12 |
| Journal issue |
7 |
| Pages of publication |
1814 - 1821 |
| a |
11.3082 ± 0.0005 Å |
| b |
24.3551 ± 0.001 Å |
| c |
11.4415 ± 0.0005 Å |
| α |
90° |
| β |
114.665 ± 0.001° |
| γ |
90° |
| Cell volume |
2863.6 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0833 |
| Residual factor for significantly intense reflections |
0.0512 |
| Weighted residual factors for significantly intense reflections |
0.1133 |
| Weighted residual factors for all reflections included in the refinement |
0.1317 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.048 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/8000476.html