Information card for entry 8107721
| Common name |
alpha-(4-(hydroxyimino)-2,5-dichloro-2,5-cyclohexadien- 1-ylidene)-benzeneacetonitrile |
| Formula |
C14 H8 Cl2 N2 O |
| Calculated formula |
C14 H8 Cl2 N2 O |
| SMILES |
ClC\1=C\C(=C(/c2ccccc2)C#N)C(=CC1=N\O)Cl |
| Title of publication |
Crystal structure of α-(4-(hydroxyimino)-2,5-dichloro-2,5-cyclohexadien- 1-ylidene)-benzeneacetonitrile, C14H8Cl2N2O |
| Authors of publication |
Hong, Zhi; Chen, Guang; Jiang, Hua-Jiang; Chen, Ren-Er; Su, Wei-Ke |
| Journal of publication |
Zeitschrift für Kristallographie - New Crystal Structures |
| Year of publication |
2015 |
| Journal volume |
230 |
| Journal issue |
2 |
| Pages of publication |
71 - 72 |
| a |
18.692 ± 0.004 Å |
| b |
5.8557 ± 0.0013 Å |
| c |
12.575 ± 0.003 Å |
| α |
90° |
| β |
106.875 ± 0.003° |
| γ |
90° |
| Cell volume |
1317.1 ± 0.5 Å3 |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0392 |
| Weighted residual factors for significantly intense reflections |
0.1127 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/8107721.html